| Identification | |
| Name: | Icaridin |
| Synonyms: | Icaridin (Picaridin);1-Methylpropyl2-(2-hydroxyethyl)-1-piperidinecarboxylate;Autan;Autan Repel;Bayrepel;Isobutyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate;KBR 3023;Picaridin;Pikaridin;Propidine; |
| CAS: | 119515-38-7 |
| EINECS: | 423-210-8 |
| Molecular Formula: | C12H23NO3 |
| Molecular Weight: | 229.32 |
| InChI: | InChI=1/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | below -170 deg C |
| Density: | 1.041 g/cm3 |
| Refractive index: | 1.477 |
| Solubility: | In water, 8.2X10+3 mg/L at 20 deg C, pH 4-9 |
| Appearance: | Colourless liquid |
| Specification: |
Icaridin , its cas register number is 119515-38-7. It also can be called Picaridin ; sec-Butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate ; 1-(1-Methylpropoxycarbonyl)-2-(2-hydroxyethyl)piperidine ; 1-Methylpropyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate ; 1-Methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate ; Autan ; Bayrepel ; 1-Piperidinecarboxylic acid, 2-(2-hydroxyethyl)-, 1-methylpropyl ester .It is a colorless liquid. It has broad efficacy against different insects. |
| Usage: |
Icaridin (CAS NO.119515-38-7) is used as Pharmaceuticals, and also as insect repellent.It acts on certain olfactory receptor cell types to reduce the activating or attracting effect of odor sources. |
| Safety Data | |
 |
|
