Identification |
Name: | 4-Octadecene-1,3-diol,2-(dimethylamino)-, (2S,3R,4E)- |
Synonyms: | N,N-Dimethylsphingenine; |
CAS: | 119567-63-4 |
Molecular Formula: | C20H41NO2 |
Molecular Weight: | 327.54504 |
InChI: | InChI=1S/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/b17-16+/t19-,20+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 1170 3 |
Density: | 0.921 g/cm3 |
Refractive index: | 1.483 |
Water Solubility: | Soluble in ethanol (25 mg/ml) and DMSO (25 mg/ml) |
Solubility: | Soluble in ethanol (25 mg/ml) and DMSO (25 mg/ml) |
Appearance: | CLEAR COLORLESS TO FAINT YELLOW LIQUID/White to off-white powder. |
Safety Data |
Hazard Symbols |
F: Flammable
|
|
|