| Identification | |
| Name: | 2-Propenoic acid,2-methyl-3-phenyl- |
| Synonyms: | Cinnamicacid, a-methyl- (7CI,8CI);2-Methyl-3-phenyl-2-propenoic acid;NSC 401113; |
| CAS: | 1199-77-5 |
| EINECS: | 214-847-0 |
| Molecular Formula: | C10H10O2 |
| Molecular Weight: | 162.19 |
| InChI: | InChI=1/C10H10O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.147 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | white crystal |
| Specification: |
?alpha-Methylcinnamic acid , its cas register number is 1199-77-5. It also can be called 2-Propenoic acid,2-methyl-3-phenyl- ;?2-Methyl-3-phenylacrylic acid .It is a?white to yellowish crystals or crystalline powder. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
