| Identification | |
| Name: | Acetic acid,2,2'-[[[4-[(aminocarbonyl)amino]phenyl]arsinidene]bis(thio)]bis- |
| Synonyms: | Aceticacid, mercapto-, S,S-diester with dithio-p-ureidobenzenearsonous acid (6CI);Acetic acid, mercapto-, diester with dithio-p-ureidobenzenearsonous acid (8CI);Benzenearsonous acid, dithio-p-ureido-, diester with mercaptoacetic acid (8CI);(p-Ureidophenylarsylenedithio)diacetic acid; 4-Carbamidophenylbis[carboxymethylthio]arsenite;Bis[carboxymethylmercapto](p-ureidophenyl)arsine; CC 914; Thiocarbarsone |
| CAS: | 120-02-5 |
| Molecular Formula: | C11H13 As N2 O5 S2 |
| Molecular Weight: | 392.30 |
| InChI: | InChI=1/C11H13AsN2O5S2/c13-11(19)14-8-3-1-7(2-4-8)12(20-5-9(15)16)21-6-10(17)18/h1-4H,5-6H2,(H,15,16)(H,17,18)(H3,13,14,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Thiocarbarsone , its CAS NO. is 120-02-5, the synonyms are (p-Ureidophenylarsylenedithio)diacetic acid ; 4-Carbamidophenyl bis(carboxymethylthio)arsenite ; Acetic acid, (p-carbamoylamino)phenylarsinobis(2-thio- ; Acetic acid, 2,2'-((4-((aminocarbonyl)amino)phenyl)arsinidene)bis(thio)bis- ; Arsine, bis(carboxymethylthio)(p-ureidophenyl)- ; Benzenearsonous acid, dithio-p-ureido-, diester with mercaptoacetic acid ; Bis(carboxymethylmercapto)(p-ureidophenyl)arsine ; C.C. No. 914 ; Chemotherapy Center No. 914 ; Mercaptoacetic acid, diester with dithio-p-ureidobenzenearsonous acid ; Phenyl urea p-di(carboxymethyl) thioarsenite ; Thiocarbarsone ; Acetic acid, mercapto-, diester with dithio-p-ureidobenzenearsonous acid . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
