Identification |
Name: | Quinoline,1,2,3,4-tetrahydro-6-methoxy- |
Synonyms: | Thalline(6CI); 1,2,3,4-Tetrahydro-6-methoxyquinoline;6-Methoxy-1,2,3,4-tetrahydroquinoline; 6-Methoxytetrahydroquinoline; NSC 49188;Thallin |
CAS: | 120-15-0 |
EINECS: | 204-374-8 |
Molecular Formula: | C10H13 N O |
Molecular Weight: | 163.24 |
InChI: | InChI=1/C10H13NO/c1-12-9-4-5-10-8(7-9)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.044 g/cm3 |
Refractive index: | 1.532 |
Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |