| Identification | |
| Name: | 2-(3,4-Dimethoxy phenyl)ethyl amine |
| Synonyms: | 3,4-Dimethoxyphenethylamine; Homoveratrylamine; Homoveratrylamin; 3,4-Dimethyloxy Phenylethylamine; 2-(3,4-Dimethyloxyphenyl)ethylamine Homoveratrylamine; AKOS 235-24; AKOS NCG1-0105; AKOS BBS-00003591; 2-(3,4-DIMETHOXYPHENYL)ETHYLAMINE; 3,4-DIMETHYLOXYPHENYLETHYLAMINE; 3,4-DIMETHOXY PHENYLETHYLAMINE; dmpea |
| CAS: | 120-20-7 |
| EINECS: | 204-376-9 |
| Molecular Formula: | C10H15NO2 |
| Molecular Weight: | 181.23 |
| InChI: | InChI=1/C10H15NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5-6,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 1.074 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.545-1.547 |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | colorless transparent liquid |
| Specification: |
?3,4-Dimethoxyphenethylamine (CAS NO.120-20-7) is also called as?2-(3,4-Dimethoxyphenyl)ethylamine ; 3,4-Di-O-methyldopamine ; 3,4-Dimethoxy-beta-phenylethylamine ; 3,4-Dimethoxybenzeneethanamine ; 3,4-Dimethoxydopamine ;?3,4-Dimethoxyphenylethylamine ; 3,4-Dimethoxyphenylethylamine (base) ; 3,4-Dimethoxyphenylethylamine(base) ; Dimethoxydopamine ; Dimethoxyphenylethylamine ; Dimethylmescaline ; Dopamine dimethyl ether ;?Homoveratrylamine ;?O,O-Dimethyldopamine ; beta-(3,4-Dimethyoxyphenyl)ethylamine?; 3,4-Dimethoxyphenethylamine ; Benzeneethanamine, 3,4-dimethoxy- ; Phenethylamine, 3,4-dimethoxy- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29222900 |
| Storage Temperature: | Do not store in direct sunlight. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store protected from moisture. Store protected from light. Store under an inert atmosphere. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
