| Identification | |
| Name: | Benzaldehyde,4-ethoxy-3-methoxy- |
| Synonyms: | 3-Methoxy-4-ethoxybenzaldehyde;4-Ethoxy-m-anisaldehyde;NSC 16945;NSC 62097;Vanillin ethyl ether;4-ethoxy-3-methoxybenzaldehyde;benzaldehyde, 4-ethoxy-3-methoxy-;4-Ethoxy-m-anisaldehyde; |
| CAS: | 120-25-2 |
| EINECS: | 204-382-1 |
| Molecular Formula: | C10H12O3 |
| Molecular Weight: | 180.2 |
| InChI: | InChI=1/C10H12O3/c1-3-13-9-5-4-8(7-11)6-10(9)12-2/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.088g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.528 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Yellow solid. |
| Specification: | YELLOW FINE CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | Flavoring. |
| Safety Data | |
 |
|
