| Identification | |
| Name: | Tropine |
| CAS: | 120-29-6 |
| EINECS: | 204-384-2 |
| Molecular Formula: | C8H15NO |
| Molecular Weight: | 141.21 |
| InChI: | InChI=1/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3 |
| Molecular Structure: | ![(C8H15NO) Tropine;α -Tropine; tropinol;1aH,5aH-Tropan-3a-ol (8CI);8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, e...](https://img.guidechem.com/casimg/120-29-6.gif) |
| Properties | |
| Transport: | 1544 |
| Density: | 1.04 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4792 (99.8 C) |
| Solubility: | H2O: 0.1 g/mL, clear |
| Appearance: | white to slightly yellow crystalline powder |
| Specification: |
?Tropine (CAS NO.120-29-6) is also named as 2,3-Dihydro-3alpha-hydroxytropidine ; 3-alpha-Tropanol ; 3alpha-Tropanol ; 5-21-01-00219 (Beilstein Handbook Reference) ; 8-Azabicyclo(3.2.1)octanol, 8-methyl- ; AI3-52686 ; BRN 0080188 ; NSC 43870 ; NSC 43871 ; Tropanol ; endo-8-Methyl-8-azabicyclo(3.2.1)octan-3-ol ;?1-alpha-H,5-alpha-H-Tropan-3-alpha-ol ; 1alphaH,5alphaH-Tropan-3alpha-ol (8CI) .?Tropine (CAS NO.120-29-6) is white to slightly yellow crystalline powder. It?is a derivative of tropane containing an oxygen atom. Benzatropine and etybenzatropine are it's derivatives. |
| Packinggroup: | III |
| HS Code: | 29399990 |
| Sensitive: | Hygroscopic |
| Usage: | Used to dilate the pupil of the eye. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
