Identification |
Name: | Benzamide,3-amino-4-methoxy-N-phenyl- |
Synonyms: | p-Anisanilide,3-amino- (6CI,8CI);1-Amino-2-methoxybenzene-5-carboxylic acid phenylamide;3-Amino-4-methoxy-N-phenylbenzamide;3-Amino-4-methoxy-N-phenylbenzoic acidamide;3-Amino-p-anisanilide;NSC 50647; |
CAS: | 120-35-4 |
EINECS: | 204-388-4 |
Molecular Formula: | C14H14N2O2 |
Molecular Weight: | 242.27 |
InChI: | InChI=1/C14H14N2O2/c1-18-13-8-7-10(9-12(13)15)14(17)16-11-5-3-2-4-6-11/h2-9H,15H2,1H3,(H,16,17) |
Molecular Structure: |
|
Properties |
Melting Point: | 154-156°C |
Flash Point: | 174.3°C |
Boiling Point: | 364.5°Cat760mmHg |
Density: | 1.245g/cm3 |
Refractive index: | 1.658 |
Appearance: | white or light yellow powder |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 174.3°C |
Safety Data |
|
|