| Identification | |
| Name: | 2,4-DP (Dichlorprop) |
| CAS: | 120-36-5 |
| EINECS: | 204-390-5 |
| Molecular Formula: | C9H8 Cl2 O3 |
| Molecular Weight: | 235.064 |
| InChI: | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61890 |
| Flash Point: | 164.5°C |
| Boiling Point: | 348.3°Cat760mmHg |
| Density: | 1.421g/cm3 |
| Solubility: | In acetone 595, isopropanol 510, benzene 85, toluene 69, xylene 51, kerosene 2.1 (all in g/L, 20 deg C). Chloroform 10.8, ether 82.1, ethanol more than 100 (all in g/100 g at 20 deg C) Heptane 0.5% wt/vol Soluble in ethanol, ether; very soluble in ligroin In water, 350 mg/L at 20 deg C |
| Appearance: | Yellowish to colorless solid |
| Specification: | Safety Statements:26-36/37-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 164.5°C |
| Storage Temperature: | APPROX 4°C |
| Color: | Colorless crystals WHITE TO TAN, CRYSTALLINE SOLID |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
