| Identification | |
| Name: | 2(3H)-Benzothiazolethione,6-ethoxy- |
| Synonyms: | 2-Benzothiazolethiol,6-ethoxy- (7CI); Benzothiazole, 6-ethoxy-2-mercapto- (6CI);2-Mercapto-6-ethoxybenzothiazole; 6-Ethoxy-1,3-benzothiazole-2-thiol;6-Ethoxy-2-benzothiazolethiol; 6-Ethoxy-2-mercaptobenzothiazole;6-Ethoxybenzothiazole-2-thione; 6-Ethoxybenzothiazoline-2-thione; NSC 503424 |
| CAS: | 120-53-6 |
| EINECS: | 204-405-5 |
| Molecular Formula: | C9H9 N O S2 |
| Molecular Weight: | 211.29 |
| InChI: | InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.37 g/cm3 |
| Refractive index: | 1.698 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
