| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 1,4-dimethyl ester |
| Synonyms: | 1,4-Benzenedicarboxylicacid, dimethyl ester (9CI);Terephthalic acid, dimethyl ester (6CI,7CI,8CI);DMT;Dimethyl 1,4-benzenedicarboxylate;Dimethyl p-benzenedicarboxylate;Dimethyl p-phthalate;Methyl 4-(carbomethoxy)benzoate;Methyl p-(methoxycarbonyl)benzoate;NSC 3503; |
| CAS: | 120-61-6 |
| EINECS: | 204-411-8 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.18 |
| InChI: | InChI=1/C10H10O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN No 281 |
| Density: | 1.29 |
| Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. |
| Refractive index: | 1.4752 |
| Solubility: | slight
|
| Appearance: | white chunks |
| Specification: | white chunks Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | Z01 |
| Color: | Colorlesss crystals NEEDLES FROM ETHER |
| Safety Data | |
 |
|
