| Identification | |
| Name: | 1,3-Benzodioxole,5-[2-(octylsulfinyl)propyl]- |
| Synonyms: | Benzene,1,2-(methylenedioxy)-4-[2-(octylsulfinyl)propyl]- (6CI,8CI);1,2-(Methylenedioxy)-4-[2-(octylsulfinyl)propyl]benzene;1-Methyl-2-(3,4-methylenedioxyphenyl)ethyl octyl sulfoxide;5-[2-(Octylsulfinyl)propyl]-1,3-benzodioxole; Isosafrole octyl sulfoxide; NSC8400; Piperonyl sulfoxide; Piperonyl sulfoxide (insecticide); Sulfox-cide;Sulfoxide; Sulfoxide (synergist); Sulfoxyl; Sulphoxide |
| CAS: | 120-62-7 |
| EINECS: | 204-412-3 |
| Molecular Formula: | C18H28 O3 S |
| Molecular Weight: | 324.52 |
| InChI: | InChI=1/C18H28O3S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17/h9-10,13,15H,3-8,11-12,14H2,1-2H3 |
| Molecular Structure: | ![(C18H28O3S) Benzene,1,2-(methylenedioxy)-4-[2-(octylsulfinyl)propyl]- (6CI,8CI);1,2-(Methylenedioxy)-4-[2-(octyl...](https://img1.guidechem.com/chem/e/dict/28/120-62-7.jpg) |
| Properties | |
| Flash Point: | 247.3°C |
| Boiling Point: | 485.2°C at 760 mmHg |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with perchloric acid. |
| Refractive index: | 1.546 |
| Solubility: | negligible
|
| Appearance: | light yellow viscous oil |
| Specification: |
Removal in wastewater treatment of Isosafrole-n-octyl sulfoxide (CAS NO.120-62-7): |
| Report: |
NCI Carcinogenesis Bioassay (feed); No Evidence: rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-124 ,1979. . NCI Carcinogenesis Bioassay (feed); Clear Evidence: mouse NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-124 ,1979. . |
| Flash Point: | 247.3°C |
| Storage Temperature: | 0-6°C |
| Color: | PALE YELLOW, VISCOUS OIL Brown liquid |
| Safety Data | |
 |
|
