| Identification | |
| Name: | Acetamide,N-(2-methylphenyl)- |
| Synonyms: | o-Acetotoluidide(7CI,8CI); 2'-Methylacetanilide; N-(o-Methylphenyl)acetamide;N-Acetyl-2-toluidine; N-Acetyl-o-toluidine; N-o-Tolylacetamide; NSC 3365;o-Acetamidotoluene; o-Acetyltoluidide; o-Methylacetanilide |
| CAS: | 120-66-1 |
| EINECS: | 204-414-4 |
| Molecular Formula: | C9H11 N O |
| Molecular Weight: | 149.1898 |
| InChI: | InChI=1S/C9H11NO/c1-7-5-3-4-6-9(7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 110 C |
| Flash Point: | 296 C |
| Boiling Point: | 296 C |
| Density: | 1.111g/cm3 |
| Refractive index: | 1.567 |
| Water Solubility: | Slightly (soluble in acetone, chloroform, toluene, benzene) AUTOIGNITION |
| Solubility: | Slightly (soluble in acetone, chloroform, toluene, benzene) AUTOIGNITION |
| Appearance: | off white to brown flake |
| Specification: |
N-(2-Methylphenyl)acetamide with CAS number of 120-66-1 is also called for Acetamide,N-(2-methylphenyl)- ; Acet-o-toluidide ; N-(2-methylphenyl)-acetamid ; N-(2-Methylphenyl)acetamide ; N-(2-Methyl-phenyl)acetamide ; O-tolylacetamide ; O-methylacetanilide ; N-acetyl-o-toluidine . Harmful if swallowed. May cause irritation of the digestive tract. Cause respiratory tract irritation. May be harmful if inhaled. Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes. Avoid ingestion and inhalation. Store in a cool, dry place. Store in a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 296 C |
| Color: | CRYSTALS COLORLESS |
| Safety Data | |
| Hazard Symbols | |
 |
|
