Identification |
Name: | Ethanol,2-(2,4-dichlorophenoxy)- |
Synonyms: | 2-(2,4-Dichlorophenoxy)ethanol;NSC 423; o,p-Dichlorophenoxyethanol |
CAS: | 120-67-2 |
EINECS: | 204-416-5 |
Molecular Formula: | C8H8 Cl2 O2 |
Molecular Weight: | 207.06 |
InChI: | InChI=1/C8H6Cl2O3.C2H6O/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-2-3/h1-3H,4H2,(H,11,12);3H,2H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 2902 |
Melting Point: | 54°C |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Safety Data |
|
|