| Identification | |
| Name: | Catechol |
| Synonyms: | 1,2-Benzenediol (pyrocatechol); 1,2-benzenediol[qr]; 1,2-dihydroxybenzene[qr]; 2-Hydroxyphenol; 2-hydroxyphenol[qr]; ai3-03995[qr]; Benzene, o-dihydroxy-; benzene,1,2-dihydroxy-; Pyrocatechol |
| CAS: | 120-80-9 |
| EINECS: | 204-427-5 |
| Molecular Formula: | C6H6O2 |
| Molecular Weight: | 110.11 |
| InChI: | InChI=1/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| Molecular Structure: | ![(C6H6O2) 1,2-Benzenediol (pyrocatechol); 1,2-benzenediol[qr]; 1,2-dihydroxybenzene[qr]; 2-Hydroxyphenol; 2-hy...](https://img.guidechem.com/casimg/120-80-9.gif) |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.371 |
| Stability: | Stable. Substances to be avoided include acid chlorides, acid anhydrides, bases, oxidizing agents, nitric acid. Light sensitive; may discolour on exposure to air. Combustible. |
| Refractive index: | 1.612 |
| Solubility: | 430 g/L (20 oC) |
| Appearance: | Light grey to light brown flake |
| Report: |
?Catechol?(CAS NO.120-80-9) is reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Color: | Monoclinic tablets, prisms from toluene Colorless crystals, discolors to brown on exposure to air and light, especially when moist |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
