| Identification | |
| Name: | R-(+)-alpha-Lipoic acid |
| Synonyms: | 1,2-Dithiolane-3-pentanoicacid, (R)-;1,2-Dithiolane-3-valeric acid, (+)- (8CI);1,2-Dithiolane-3-pentanoicacid, (3R)-;(R)-Lipoic acid;(R)-a-Lipoic acid;Berlition;Byodinoral 300;Lipoec;Lipoic acid;R-(+)-Thioctic acid;Thioderm;Thiogamma;Tiobec;Tiobec Retard;d-Thioctic acid;a-(+)-Lipoic acid;a-Lipoic acid; |
| CAS: | 1200-22-2 |
| Molecular Formula: | C8H14O2S2 |
| Molecular Weight: | 206.33 |
| InChI: | InChI=1/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.218 g/cm3 |
| Appearance: | Yellow Crystalline Solid |
| Specification: |
?R-(+)-alpha-Lipoic acid , its cas register number 1200-22-2. It also can be called?R-(+)-alpha-Lipoic acid?; and?(R)-(+)-1,2-Dithiolane-3-pentanoic acid . |
| Usage: | R-(+)-alpha-Lipoic acid (CAS NO.1200-22-2) can be used as a fat-metabolism stimulator . |
| Safety Data | |
 |
|
