| Identification | |
| Name: | Iodine pentoxide |
| Synonyms: | Diiodinepentoxide; Iodic anhydride; Iodine oxide; Iodine (V) oxide, 99% (Assay); |
| CAS: | 12029-98-0 |
| EINECS: | 234-740-2 |
| Molecular Formula: | I2O5 |
| Molecular Weight: | 333.81 |
| InChI: | InChI=1/I2O5/c3-1(4)7-2(5)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3085 |
| Melting Point: | 300-350°C (dec.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 5 |
| Stability: | Stability Strong oxidizer - contact with combustible material may cause fire. Light and moisture sensitive. Incompatible with organic materials, combustible materials, water. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | needle shaped crystals |
| Specification: |
Iodine(v) oxide (12029-98-0),which also can be called for Iodineoxide(i2o5) ; Iodine(v) oxide ; Iodine pentoxide ; Iodine pentaoxide ; Iodine oxide ; Iodic anhydride ; Iodic acid anhydride ; Iodopentoxide . Iodine(v) oxide (12029-98-0) is a stability strong oxidizer and it may cause fire when contact with combustible material.It's light and moisture sensitive and incompatible with organic materials,combustible materials and water.It's soluble in water. Iodine(v) oxide (12029-98-0) is needle shaped crystals and it's odorless.This chemical is stable under normal temperatures and pressures.It may decompose when exposed to light.When heated to decomposition it emits toxic fumes of I−. |
| Packinggroup: | II |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
O:Oxidizingagent
C:Corrosive
|
 |
|
