| Identification | |
| Name: | 4-Piperidinamine,1-(phenylmethyl)-, hydrochloride (1:2) |
| Synonyms: | 4-Piperidinamine,1-(phenylmethyl)-, dihydrochloride (9CI);Piperidine, 4-amino-1-benzyl-, dihydrochloride(6CI,7CI,8CI);1-Benzyl-4-aminopiperidine dihydrochloride;4-Amino-1-benzylpiperidine dihydrochloride; |
| CAS: | 1205-72-7 |
| EINECS: | 214-886-3 |
| Molecular Formula: | C12H18N2.2HCl |
| Molecular Weight: | 281.22 |
| InChI: | InChI=1/C12H18N2/c13-12-6-8-14(9-7-12)10-11-4-2-1-3-5-11/h1-5,12H,6-10,13H2/p+2 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Appearance: | very slight yellow to white. |
| Specification: |
The 4-Amino-1-benzylpiperidine dihydrochloride hydrate, with the CAS registry number 1205-72-7 and EINECS registry number 214-886-3, has the systematic name of 1-benzylpiperidin-4-amine dihydrochloride. It is a kind of white to very slightly yellow fine crystaline powder, and belongs to the following product categories: Pyridine series; Amines; Pyrans, Piperidines & Piperazines. The molecular formula of the chemical is C12H18N2.2HCl. What's more, while dealing with this chemical, you had better avoid contact with skin and eyes. The characteristics of 4-Amino-1-benzylpiperidine dihydrochloride hydrate are as followings: (1)ACD/LogP: 1.36; (2)# of Rule of 5 Violations: 0 ; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 29.26 Å2; (11)Flash Point: 164.8 °C; (12)Enthalpy of Vaporization: 60.51 kJ/mol; (13)Boiling Point: 349 °C at 760 mmHg; (14)Vapour Pressure: 3.42E-05 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
