| Identification |
| Name: | Cyclohexanecarbonitrile,1-(4-methylphenyl)- |
| Synonyms: | Cyclohexanecarbonitrile,1-p-tolyl- (7CI,8CI);1-(4-Methylphenyl)cyclohexanecarbonitrile;NSC 155170;1-(4-methylphenyl)cyclohexanecarbonitrile;cyclohexanecarbonitrile, 1-(4-methylphenyl)-;1-(4-Methylphenyl)-1-cyclohexanecarbonitrile; |
| CAS: | 1206-13-9 |
| EINECS: | 214-888-4 |
| Molecular Formula: | C14H17N |
| Molecular Weight: | 199.2915 |
| InChI: | InChI=1/C14H17N/c1-12-5-7-13(8-6-12)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.00 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5302-1.5322 |
| Appearance: | clear colourless to yellowish liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
