| Identification | |
| Name: | 9-chloroacridine |
| Synonyms: | - |
| CAS: | 1207-69-8 |
| EINECS: | 214-895-2 |
| Molecular Formula: | C13H8ClN |
| Molecular Weight: | 213.66 |
| InChI: | InChI=1/C13H8ClN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 1.312 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.728 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | Green to brown solid |
| Specification: |
?9-Chloroacridine (1207-69-8) is pharmaceutical material which also can be called for Acridine, 9-chloro- . And it can be used for pharmaceutical intermediates. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
