| Identification | |
| Name: | Benzenamine,2-[(4-aminophenyl)methyl]- |
| Synonyms: | Aniline,2,4'-methylenedi- (7CI,8CI); 2,4'-Diaminodiphenylmethane;2,4'-Diphenylmethanediamine; 2,4'-Methylenebis(aniline);2,4'-Methylenedianiline; 2,4'-Methylenediphenylamine;2',4-Bis(aminophenyl)methane; o,p'-Diaminodiphenylmethane |
| CAS: | 1208-52-2 |
| EINECS: | 214-900-8 |
| Molecular Formula: | C13H14 N2 |
| Molecular Weight: | 198.29 |
| InChI: | InChI=1/C13H14N2/c14-12-7-5-10(6-8-12)9-11-3-1-2-4-13(11)15/h1-8H,9,14-15H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 88 - 89 |
| Flash Point: | 226.6°C |
| Boiling Point: | 389.9°Cat760mmHg |
| Density: | 1.143g/cm3 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. |
| Refractive index: | 1.66 |
| Specification: |
2,4'-Methylenedianiline ,its cas register number is 1208-52-2. It also can be called Benzenamine, 2-[(4-aminophenyl)methyl]- ; 2,4'-Diaminodiphenylmethan ; and 2-(4-Aminobenzyl)aniline . 2,4'-Methylenedianiline (CAS NO.1208-52-2) is readily oxidzable, and emits toxic fumes when heated to decomposition. It may be toxic upon inhalation or skin contact. Neutralizes acids in exothermic reactions to form salts plus water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 226.6°C |
| Safety Data | |
 |
|
