| Identification | |
| Name: | Benzamide,N-(4-amino-2-chloro-5-methylphenyl)- |
| Synonyms: | m-Benzotoluidide,4'-amino-6'-chloro- (6CI,8CI); 4'-Amino-6'-chloro-m-benzotoluidide; FastBordeaux 3B base; NSC 76549 |
| CAS: | 121-22-2 |
| EINECS: | 204-456-3 |
| Molecular Formula: | C14H13 Cl N2 O |
| Molecular Weight: | 260.72 |
| InChI: | InChI=1/C14H13ClN2O/c1-9-7-13(11(15)8-12(9)16)17-14(18)10-5-3-2-4-6-10/h2-8H,16H2,1H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1789 8/PG 2 |
| Melting Point: | 194 °C (dec.)(lit.) |
| Flash Point: | 163.8°C |
| Boiling Point: | 347.3°Cat760mmHg |
| Density: | 1.311g/cm3 |
| Refractive index: | 1.675 |
| Specification: | Safety Statements:2-46-37/39-26 2:Keep out of the reach of children 46:If swallowed, seek medical advice immediately and show this container or label 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 163.8°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
