| Identification | |
| Name: | 2-Oxiranecarboxylicacid, 3-phenyl-, ethyl ester |
| Synonyms: | Glycidicacid, 3-phenyl-, ethyl ester (6CI,7CI,8CI); Oxiranecarboxylic acid, 3-phenyl-,ethyl ester (9CI); Ethyl 2,3-epoxy-3-phenylpropionate; Ethyl3-phenyl-2-oxiranecarboxylate; Ethyl 3-phenylglycidate; Ethyl phenylglycidate;Ethyl a,b-epoxyhydrocinnamate; NSC 8899 |
| CAS: | 121-39-1 |
| EINECS: | 204-467-3 |
| Molecular Formula: | C11H12 O3 |
| Molecular Weight: | 192.21 |
| InChI: | InChI=1/C11H12O3/c1-2-13-11(12)10-9(14-10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.102 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.518 |
| Water Solubility: | slight Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The m |
| Solubility: | slight
|
| Appearance: | pale yellow liquid |
| Specification: |
Epoxides are highly reactive. They polymerize in the presence of catalysts or when heated. These polymerization reactions can be violent. Compounds in this group react with acids, bases, and oxidizing and reducing agents. They react, possibly violently with water in the presence of acid and other catalysts. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture Sensitive |
| Color: | COLORLESS TO PALE-YELLOW LIQUID |
| Safety Data | |
 |
|
