| Identification | |
| Name: | 9-Anthracenecarbonitrile |
| Synonyms: | 9-Cyanoanthracene |
| CAS: | 1210-12-4 |
| EINECS: | 214-909-7 |
| Molecular Formula: | C15H9N |
| Molecular Weight: | 203.24 |
| InChI: | InChI=1/C15H9N/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.2 g/cm3 |
| Refractive index: | 1.719 |
| Water Solubility: | Stability Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicologynot fully investigated. Toxicity data (The meaning of any toxicologi |
| Solubility: |
|
| Appearance: | White solid |
| Specification: |
9-Anthroylnitrile , its cas register number is 1210-12-4. It also can be called 9-Cyanoanthracene ; NSC 26997 ; 9-Anthracenecarbonitrile ; 9-Anthronitrile (8CI) .It is a solid. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
