| Identification | |
| Name: | 5H-Dibenzo[a,d]cyclohepten-5-one,10,11-dihydro- |
| Synonyms: | 10,11-Dihydro-5H-dibenzo[a,d]cycloheptan-5-one;10,11-Dihydro-5H-dibenzo[a,d]cycloheptatrien-5-one;10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-one;10,11-Dihydrodibenzo[a,d]cyclohepten-5-one;2,3:6,7-Dibenzosuberone;Dibenzo[a,d]cyclohepta[1,4]dien-5-one;Dibenzo[a,d]cycloheptadien-5-one;Dibenzocycloheptenone;Dibenzosuberan-5-one;NSC 49727; |
| CAS: | 1210-35-1 |
| EINECS: | 214-912-3 |
| Molecular Formula: | C15H12O |
| Molecular Weight: | 208.26 |
| InChI: | InChI=1/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8H,9-10H2 |
| Molecular Structure: | ![(C15H12O) 10,11-Dihydro-5H-dibenzo[a,d]cycloheptan-5-one;10,11-Dihydro-5H-dibenzo[a,d]cycloheptatrien-5-one;10...](https://img.guidechem.com/casimg/1210-35-1.gif) |
| Properties | |
| Transport: | 200kgs |
| Flash Point: | 112 C |
| Density: | 1.156 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6332-1.6352 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble
Appearance:Clear
to yellow liquid Transport Information:200kgs Hazard Symbols:UN NO. Safety:An eye irritant. When heated to decomposition it emits acrid smoke and irritating vapors. |
| Appearance: | Clear to yellow liquid |
| HS Code: | 29143900 |
| Flash Point: | 112 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols | |
 |
|
