| Identification | |
| Name: | [1,1'-Biphenyl]-4-amine,4'-nitro- |
| Synonyms: | 4-Biphenylamine,4'-nitro- (6CI,7CI,8CI); (4'-Nitrobiphenyl-4-yl)amine;4-Amino-4'-nitro-1,1'-biphenyl; 4-Amino-4'-nitrobiphenyl;4-Nitro-4'-aminodiphenyl; 4'-Nitro-4-aminodiphenyl; 4'-Nitro-4-biphenylamine;4'-Nitro-[1,1'-biphenyl]-4-amine |
| CAS: | 1211-40-1 |
| Molecular Formula: | C12H10 N2 O2 |
| Molecular Weight: | 214.22 |
| InChI: | InChI=1/C12H10N2O2/c13-11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(15)16/h1-8H,13H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 204°C |
| Flash Point: | 188.9°C |
| Boiling Point: | 388.7°C at 760 mmHg |
| Density: | 1.268g/cm3 |
| Stability: | Stability |
| Refractive index: | 1.65 |
| Specification: |
4-Amino-4'-nitrobiphenyl (CAS NO.1211-40-1) is also called AKOS AUF02004; [1,1'-Biphenyl]-4-amine, 4'-nitro- ; 4'-Nitro-4-biphenylamin ; 4'-Nitro[1,1'-biphenyl]-4-amine . 4-Amino-4'-nitrobiphenyl (CAS NO.1211-40-1) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 188.9°C |
| Safety Data | |
 |
|
