| Identification | |
| Name: | Benzene,1-ethoxy-2,3-difluoro- |
| Synonyms: | 1,2-Difluoro-3-ethoxybenzene;2,3-Difluoro-1-ethoxybenzene;2,3-Difluorophenyl ethyl ether;1-ethoxy-2,3-difluorobenzene;1-Ethoxy-2,3-difluorobenzene;1-Ethoxy-2,3-difluorbenzol;benzene, 1-ethoxy-2,3-difluoro-; |
| CAS: | 121219-07-6 |
| Molecular Formula: | C8H8F2O |
| Molecular Weight: | 158.15 |
| InChI: | InChI=1/C8H8F2O/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 70.5 |
| Boiling Point: | 178 |
| Density: | 1.1784 |
| Refractive index: | 1.455 |
| Specification: |
2,3-Difluorophenetole , its cas register number is 121219-07-6. It also can be called 1-Ethoxy-2,3-difluorbenzol ; 1-Ethoxy-2,3-difluorobenzene ; 2,3-Difluorophenyl ethyl ether ; and Benzene, 1-ethoxy-2,3-difluoro- . |
| Flash Point: | 70.5 |
| Storage Temperature: | Keep Cold |
| Safety Data | |
 |
|
