| Identification | |
| Name: | 4-Pentylbenzeneboronic acid |
| Synonyms: | Boronicacid, (4-pentylphenyl)- (9CI);Boronic acid,B-(4-pentylphenyl)-;(4-n-Pentylphenyl)boronic acid; |
| CAS: | 121219-12-3 |
| Molecular Formula: | C11H17BO2 |
| Molecular Weight: | 192.06 |
| InChI: | InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01 g/cm3 |
| Refractive index: | 1.509 |
| Appearance: | tan powder |
| Specification: |
4-Pentylbenzeneboronic acid (CAS NO.121219-12-3) also can be called (4-Pentylphenyl)boronic acid ; Boronic acid, B-(4-pentylphenyl)- ; 4-n-Amylbenzeneboronic acid . 4-Pentylbenzeneboronic acid (CAS NO.121219-12-3) is tan powder. |
| Usage: |
4-Pentylbenzeneboronic acid (CAS NO.121219-12-3) is used as intermediates of liquid crystals. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
