| Identification | |
| Name: | Zineb |
| Synonyms: | Blizene;Zebenide;Carbadine;Hexathane;[2-(sulfidocarbothioylamino)ethylamino]methanedithioate; zinc(+2) cation;Zebtox;Lonacol;Bonzeb;Zinosan;ENT 14,874;ZIDAN;Aspor;Novozir N;Parzate zineb;Discon;Turbair Zineb Fungicide;Dipher;Zinc,[[2-[(dithiocarboxy)amino]ethyl]- carbamodithioato(2-)-kS,kS']-;Funjeb;Tritoftorol;Curit;Perozin;Crittox;Dithane Z 78;Phytox;Tiezene;Unizeb;Polyram Z;Lirotan;Fungo-Pulvit;Indofil Z 78;Cynkotox; |
| CAS: | 12122-67-7 |
| EINECS: | 235-180-1 |
| Molecular Formula: | C4H6N2S4Zn |
| Molecular Weight: | 275.76 |
| InChI: | InChI=1/C4H8N2S4.Zn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-1/rC4H6N2S4Zn/c7-3(8)5-1-2-6-4-9-11-10-4/h6H,1-2H2,(H-,5,7,8)/p+1 |
| Molecular Structure: | ![(C4H6N2S4Zn) Blizene;Zebenide;Carbadine;Hexathane;[2-(sulfidocarbothioylamino)ethylamino]methanedithioate; zinc(+...](https://img.guidechem.com/casimg/12122-67-7.gif) |
| Properties | |
| Transport: | 61880? |
| Melting Point: | 157 deg C (decomposes) |
| Density: | g/cm3 |
| Stability: | Unstable to light, moisture and heat on prolonged storage. Terminal stability (40 C), 1-5% degradation after one month. Non-volatile under normal field conditions. Half-life of 38.1 Days in aqueous media at pH 9. |
| Solubility: | Insoluble |
| Appearance: | An off-white powder. |
| Specification: |
?Zineb ,its cas register number is 12122-67-7. It also can be called Carbamodithioic acid, N,N'-1,2-ethanediylbis-, zinc salt (1:1) ; Zinc 1,2-ethanediyldicarbamodithioate ; Zinc ethane-1,2-diylbis(dithiocarbamate) ; 1,2-Ethanediylbiscarbamodithioic acid zinc complex and carbamodithioic acid, 1,2-ethanediylbis-, zinc salt (1:1) . Zineb (CAS NO.12122-67-7) is a foliate fungicide and is a polymeric complex of zinc with the ethylene bis(dithiocarbamate) anionic ligand. Ethylene bis(dithiocarbamate) (Maneb) was included in a biocide ban proposed by the Swedish Chemicals Agency and approved by the European Parliament in January 13, 2009. |
| Packinggroup: | I; II; III |
| Color: | Powder or crystals from chloroform + alcohol Light-tan solid WHITE POWDER OR CRYSTALS Pale yellow powder |
| Usage: | Fungicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
