| Identification | |
| Name: | Cyclopropanepropanoicacid, a-amino-, (aR)- |
| Synonyms: | Cyclopropanepropanoicacid, a-amino-, (R)- (9CI);D-3-(Cyclopropyl)alanine;(2R)-2-Ammonio-3-cyclopropylpropanoate; |
| CAS: | 121786-39-8 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c1-4(6(8)9)7-5-2-3-5/h4-5,7H,2-3H2,1H3,(H,8,9)/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.9°C |
| Boiling Point: | 258°Cat760mmHg |
| Density: | 1.218g/cm3 |
| Refractive index: | 1.496 |
| Specification: |
D-Cyclopropylalanine with cas registry number of 121786-39-8 is also known as 3-Cyclopropyl-d-alanine ; Beta-cyclopropyl-d-alanine ; D-cyclopropylalanine ; H-beta-cyclopropyl-d-ala-OH ; H-d-ala(beta-cyclopropyl)-OH ; H-d-ala(cpro)-OH ; H-d-ala(cyclopropyl)-OH ; (R)-2-amino-3-cyclopropyl-propionic acid . It is an unusual amino acid with the appearance of white crystalline powder. It can be soluble in Ethanol , Methanol and other related organic solvents. |
| Flash Point: | 109.9°C |
| Storage Temperature: | -15°C |
| Safety Data | |
 |
|
