| Identification | |
| Name: | 4-Isopropylbenzaldehyde |
| Synonyms: | 4-(1-Methylethyl)-Benzaldehyd;4-(1-Methylethyl)Benzaldehyde;4-(1-Methylethyl)-Benzaldehyde;4-(2-Propyl)Benzaldehyde;4-Ipr-Benzaldehyde;Benzaldehyde, P-Isopropyl-;Cumal;Cumic Aldehyde;Cumaldehyde; |
| CAS: | 122-03-2 |
| EINECS: | 204-516-9 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.979 |
| Stability: | No data. |
| Refractive index: | 1.529-1.532 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble (Soluble in alcohol) |
| Appearance: | clear colorless to yellow liquid |
| Specification: |
Cumaldehyde (CAS NO.122-03-2) is a natural organic compound with clear colorless to yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29122900 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Usage: | Substance is used in as an aroma for perfumes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
