| Identification | |
| Name: | Benzenecarboximidamide,4,4'-(1,2-ethenediyl)bis- |
| Synonyms: | 4,4'-Stilbenedicarboxamidine(7CI,8CI); 4,4'-Vinylenedi(benzamidine); Ba 2652; Stilbamidin; Stilbamidine |
| CAS: | 122-06-5 |
| EINECS: | 204-519-5 |
| Molecular Formula: | C16H16 N4 |
| Molecular Weight: | 264.36 |
| InChI: | InChI=1/C16H16N4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H,(H3,17,18)(H3,19,20)/b2-1+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 229.8°C |
| Boiling Point: | 456.4°Cat760mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.634 |
| Specification: |
4,4′-Stilbenedicarboxamidine , its CAS number is 122-06-5, it can be called Stilbamidinum ; Benzamidine, 4,4'-vinylenedi- ; Diamidino stilbene and so on. |
| Report: |
4,4′-Stilbenedicarboxamidine (CAS NO. 122-06-5) can be reported in USXXAM United States Patent Document. |
| Flash Point: | 229.8°C |
| Safety Data | |
 |
|
