| Identification | |
| Name: | Ethanedithioamide,N1,N2-dicyclohexyl- |
| Synonyms: | Ethanedithioamide,N,N'-dicyclohexyl- (9CI); Oxamide, N,N'-dicyclohexyldithio- (6CI,7CI,8CI);N,N'-Dicyclohexyldithiooxamide; NSC 44703 |
| CAS: | 122-36-1 |
| EINECS: | 204-537-3 |
| Molecular Formula: | C14H24 N2 S2 |
| Molecular Weight: | 284.48 |
| InChI: | InChI=1/C14H24N2S2/c17-13(15-11-7-3-1-4-8-11)14(18)16-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,15,17)(H,16,18) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150-154 °C(lit.) |
| Flash Point: | 192.2°C |
| Boiling Point: | 394.2°Cat760mmHg |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.591 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 192.2°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
