| Identification | |
| Name: | 2-Propenoic acid,3-phenyl-, 2-methylpropyl ester |
| Synonyms: | Cinnamicacid, isobutyl ester (6CI,7CI,8CI);Labdanol;NSC 404181; |
| CAS: | 122-67-8 |
| EINECS: | 204-564-0 |
| Molecular Formula: | C13H16O2 |
| Molecular Weight: | 204.27 |
| InChI: | InChI=1/C13H16O2/c1-11(2)10-15-13(14)9-8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b9-8+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.003 |
| Refractive index: | 1.5400 |
| Specification: |
?Isobutyl cinnamate (122-67-8),which also can be called for?FEMA 2193 ; Isobutyl cinnamate ; 2-Methylpropyl 3-phenylpropenoate ; 2-Methylpropyl beta-phenylacrylate ; 2-Methylpropyl3-phenyl-2-propenoate ; 2-Propenoicacid,3-phenyl-,2-methylpropylester ; 3-Phenyl-2-propenoicaci2-methylpropylester ; Cinnamic acid,isobutyl ester .?Isobutyl cinnamate (122-67-8) is a colourless?oily liquids and it's insoluble in water.It's?soluble in Ethanol , Ethyl ether , Chloroform ,and most of the volatile oil,slightly soluble in Propylene glycol .When heated to decomposition it emits acrid smoke and fumes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
