| Identification | |
| Name: | Propanoic acid,2-phenylethyl ester |
| Synonyms: | NSC 404457;EcoPCO ACU;Propionicacid, phenethyl ester (6CI,7CI,8CI);2-Phenethyl propionate;2-Phenylethylpropanoate;Benzylcarbinyl propionate;Phenethyl alcohol propionate;Phenethyl propanoate;Phenethylpropionate;Phenylethyl propionate;b-Phenylethyl propionate; |
| CAS: | 122-70-3 |
| EINECS: | 204-397-3 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-2-11(12)13-9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.493(lit.) |
| Solubility: | Miscible with alcohols and ether In water, 278 mg/L at 25 deg C (est) |
| Appearance: | colorless to pale yellow clear liquid |
| Specification: | Clear colorless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
