| Identification | |
| Name: | Benzenepropanol,1-acetate |
| Synonyms: | 1-Propanol,3-phenyl-, acetate (6CI,7CI,8CI); Benzenepropanol, acetate (9CI);(3-Acetoxypropyl)benzene; 1-Acetoxy-3-phenylpropane; 3-Acetoxy-1-phenylpropane;3-Phenyl-1-propanol acetate; 3-Phenyl-1-propyl acetate; 3-Phenylpropyl acetate;Acetic acid 3-phenylpropyl ester; Hydrocinnamyl acetate; NSC 404453; g-Phenylpropyl acetate |
| CAS: | 122-72-5 |
| EINECS: | 204-569-8 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.2277 |
| InChI: | InChI=1S/C11H14O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -60 °C |
| Flash Point: | >230 °F |
| Boiling Point: | 244 °C(lit.) |
| Density: | 1.012 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.496(lit.) |
| Specification: |
3-Phenylpropyl acetate with cas registry number of 122-72-5 is also called for (3-Acetoxypropyl)benzene ; 1-Acetoxy-3-phenylpropane ; 1-Propanol, 3-phenyl-, acetate ; 3-Acetoxy-1-phenylpropane ; 3-Phenyl-1-propanol, acetate ; 3-Phenyl-1-propyl acetate ; 3-Phenylpropyl acetate (natural) ; 4-06-00-03201 (Beilstein Handbook Reference) ; AI3-18533 ; Benzenepropanol, acetate ; Benzenepropanol, 1-acetate ; FEMA No. 2890 ; Hydrocinnamyl acetate ; NSC 404453 ; Phenylpropyl acetate ; UNII-AKW166708I . It is colorless clear liquid with floral-like - spicy odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | >230 °F |
| Safety Data | |
 |
|
