| Identification | |
| Name: | 2-Propanone,1-(4-methoxyphenyl)- |
| Synonyms: | 2-Propanone,(p-methoxyphenyl)- (6CI,7CI);2-Propanone, 1-(p-methoxyphenyl)- (8CI);1-(4-Methoxyphenyl)-2-propanone;1-(4-Methoxyphenyl)acetone;1-(p-Anisyl)-2-propanone;1-(p-Methoxyphenyl)-2-propanone;4-Methoxybenzylmethyl ketone;4'-Methoxyphenyl-2-propanone;Anisketone;Anisyl methyl ketone;NSC 22983;NSC 46101;p-Acetonylanisole;p-Methoxybenzyl methyl ketone;p-Methoxyphenylacetone; |
| CAS: | 122-84-9 |
| EINECS: | 204-578-7 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -15 |
| Density: | 1.067 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.52-1.53 |
| Water Solubility: | Freely soluble in alcohol |
| Solubility: | Freely soluble in alcohol |
| Appearance: | Pale Yellow Liquid |
| Specification: | Pale Yellow Liquid usageEng:A volatile compound released by flowering plants to attractant insects Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A volatile compound released by flowering plants to attractant insects |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
