| Identification | |
| Name: | 4-n-Butoxyphenol |
| Synonyms: | - |
| CAS: | 122-94-1 |
| EINECS: | 204-583-4 |
| Molecular Formula: | C10H14O2 |
| Molecular Weight: | 166.22 |
| InChI: | InChI=1/C10H14O2/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-7,11H,2-3,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.029 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.423 |
| Appearance: | white crystalline powder |
| Specification: |
Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. Use with adequate ventilation. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xi:Irritant
|
 |
|
