| Identification | |
| Name: | 1,4-Piperazinediethanol |
| Synonyms: | 1,4-Bis(2-hydroxyethyl)piperazine;1,4-Di(2-hydroxyethyl)piperazine;N,N'-Bis(b-hydroxyethyl)piperazine;N,N'-Di(2-hydroxyethyl)piperazine;NSC 26892;NSC 31268;NSC 36645;1,4-Bis(b-hydroxyethyl)piperazine; |
| CAS: | 122-96-3 |
| EINECS: | 204-586-0 |
| Molecular Formula: | C8H18N2O2 |
| Molecular Weight: | 174.24 |
| InChI: | InChI=1/C8H18N2O2/c11-7-5-9-1-2-10(4-3-9)6-8-12/h11-12H,1-8H2/p+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 133 - 136 C |
| Boiling Point: | 215 - 220 at 50 mmHg |
| Density: | 1.097 g/cm3 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols | |
 |
|
