| Identification | |
| Name: | Gemcitabine hydrochloride |
| Synonyms: | Gemcitabine HCl;2',2'-Difluorodeoxycytidine monohydrochloride;2'-Deoxy-2',2'-difluorocytidine monohydrochloride;2'-Deoxy-2',2'-difluorocytidine monohydrochloride (beta-isomer); |
| CAS: | 122111-03-9 |
| Molecular Formula: | C9H11F2N3O4.HCl |
| Molecular Weight: | 299.66 |
| InChI: | InChI=1/C9H11F2N3O4.ClH/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17;/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17);1H/t4-,6-,7-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | == |
| Solubility: | In water, 5.13X10+4 mg/L at 25 deg C (est) |
| Appearance: | White crystalline granular, odorless |
| Biological Activity: | Deoxycytidine analog that inhibits DNA synthesis. Metabolized to form gemcitabine triphosphate (dFdCTP) and gemcitabine diphosphate (dFdCDP). dFdCTD inhibits ribonucleotide reductase causing a reduction in cellular nucleotides. dFdCTP is incorporated in DNA resulting in DNA strand termination. Displays antitumor activity in vitro and in vivo . |
| Color: | Crystals from water, pH = 8.5 |
| Usage: | An antineoplastic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
