| Identification |
| Name: | 2-Propenethioamide,2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)- |
| CAS: | 122520-86-9 |
| Molecular Formula: | C10H8N2O2S |
| Molecular Weight: | 220.24772 |
| InChI: | InChI=1S/C10H8N2O2S/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,14-15H,12H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.583 g/cm3 |
| Refractive index: | 1.78 |
| Water Solubility: | DMSO: 50 mg/mL, clear, orange |
| Solubility: | DMSO: 50 mg/mL, clear, orange |
| Appearance: | White solid |
| Biological Activity: | Epidermal growth factor receptor (EGFR) and platelet-derived growth factor receptor (PDGFR) kinase inhibitor (IC 50 values are 2.4 and 3 μ M respectively). Stimulates microtubule polymerization and promotes neurite outgrowth > 17-fold over basal conditions in vitro . Also weakly inhibits protein kinase C (IC 50 = 60 μ M). |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
