Identification |
Name: | Cyclohexanone,(1,3-benzodioxol-5-ylmethyl)- (9CI) |
Synonyms: | Cyclohexanone,piperonyl- (8CI); Piperonyl cyclohexanone |
CAS: | 12261-99-3 |
Molecular Formula: | C14H16 O3 |
Molecular Weight: | 232.30 |
InChI: | InChI=1/C14H16O3/c15-12-4-2-1-3-11(12)7-10-5-6-13-14(8-10)17-9-16-13/h5-6,8,11H,1-4,7,9H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 167.7°C |
Boiling Point: | 367.9°Cat760mmHg |
Density: | 1.207g/cm3 |
Refractive index: | 1.569 |
Specification: |
Piperonyl cyclohexanone , its cas register number is 12261-99-3. It also can be called Cyclohexanone, piperonyl- ;
CID202582 ; LS-57356 . When heated to decomposition it emits acrid smoke and irritating vapors.
|
Flash Point: | 167.7°C |
Safety Data |
|
|