| Identification | |
| Name: | 3,4-Dimethoxyphenylboronic acid |
| Synonyms: | Boronicacid, (3,4-dimethoxyphenyl)- (9CI); |
| CAS: | 122775-35-3 |
| EINECS: | -0 |
| Molecular Formula: | C8H11BO4 |
| Molecular Weight: | 181.98 |
| InChI: | InChI=1/C8H11BO4/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5,10-11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.517 |
| Water Solubility: | 25 g/L |
| Solubility: | 25 g/L in water |
| Appearance: | white to light beige powder and granules |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
