Identification |
Name: | Estra-1,3,5(10)-triene-3,16,17-triol,(16a,17a)- |
Synonyms: | Estra-1,3,5(10)-triene-3,16a,17a-triol (7CI,8CI); 16a,17a-Estriol; 16a-Hydroxy-17a-estradiol; 17-Epiestriol; 17-epi-Estriol;17a-Estriol; NSC 84051 |
CAS: | 1228-72-4 |
Molecular Formula: | C18H24 O3 |
Molecular Weight: |
288.38 |
InChI: | InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17-,18+/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 220.8°C |
Boiling Point: | 469°Cat760mmHg |
Density: | 1.255g/cm3 |
Refractive index: | 1.624 |
Flash Point: | 220.8°C |
Color: | off-white to yellow |
Usage: | A metabolite of Estradiol |
Safety Data |
|
 |