| Identification | |
| Name: | 10H-Phenothiazine,10-[(1-methyl-3-pyrrolidinyl)methyl]-, hydrochloride (1:1) |
| Synonyms: | 10H-Phenothiazine,10-[(1-methyl-3-pyrrolidinyl)methyl]-, monohydrochloride (9CI); Phenothiazine,10-[(1-methyl-3-pyrrolidinyl)methyl]-, monohydrochloride (8CI); Dilosyn;Disyncran; Methdilazine hydrochloride; Methdilazine monohydrochloride; NSC169091; Tacaryl; Tacaryl hydrochloride |
| CAS: | 1229-35-2 |
| EINECS: | 214-967-3 |
| Molecular Formula: | C18H20 N2 S . Cl H |
| Molecular Weight: | 332.92 |
| InChI: | InChI=1/C18H20N2S/c1-19-11-10-14(12-19)13-20-15-6-2-4-8-17(15)21-18-9-5-3-7-16(18)20/h2-9,14H,10-13H2,1H3 |
| Molecular Structure: | ![(C18H20N2S.ClH) 10H-Phenothiazine,10-[(1-methyl-3-pyrrolidinyl)methyl]-, monohydrochloride (9CI); Phenothiazine,10-[...](https://img1.guidechem.com/chem/e/dict/25/1229-35-2.jpg) |
| Properties | |
| Melting Point: | 187.5-189 DEG C |
| Flash Point: | 214.1°C |
| Boiling Point: | 430.4°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.642 |
| Solubility: | 1 G IN 2 ML WATER, 2 ML ALC, 6 ML CHLOROFORM, MORE THAN 10,000 ML ETHER |
| Specification: |
Reactivity Profile: Methdilazine hydrochloride (200 MG) is sensitive to exposure to light. An acidic salt. Materials in this group are generally soluble in water. The resulting solutions contain moderate concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. |
| Flash Point: | 214.1°C |
| Color: | LIGHT-TAN, CRYSTALLINE POWDER CRYSTALS FROM ISOPROPYL ALCOHOL |
| Safety Data | |
 |
|
