Identification |
Name: | Heptane,3-(chloromethyl)- |
Synonyms: | 1-Chloro-2-ethylhexane;2-Ethylhexyl chloride;3-(Chloromethyl)heptane;NSC 8883; |
CAS: | 123-04-6 |
EINECS: | 204-594-4 |
Molecular Formula: | C8H17Cl |
Molecular Weight: | 148.67 |
InChI: | InChI=1/C8H17Cl/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 0.882 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.432-1.436 |
Solubility: | 0.0503 g/L (20 ºC) |
Appearance: | Clear, colorless liquid. |
Specification: | Liquid usageEng:Barchlor(R) 8I is used as chemical intermediate. Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Packinggroup: | I; II; III |
Storage Temperature: | Keep away from heat, sparks, and flame. |
Usage: | Barchlor(R) 8I is used as chemical intermediate. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |