| Identification | |
| Name: | Benzene,1-chloro-4-(methylthio)- |
| Synonyms: | Sulfide,p-chlorophenyl methyl (6CI,7CI,8CI); 1-Chloro-4-(methylthio)benzene;4-Chlorophenyl methyl sulfide; 4-Chlorothioanisole;4-Methylthio-1-chlorobenzene; Methyl 4-chlorophenyl sulfide; Methylp-chlorophenyl sulfide; NSC 72090; p-(Methylthio)chlorobenzene; p-Chlorophenylmethyl sulfide; p-Chlorothioanisole |
| CAS: | 123-09-1 |
| EINECS: | 204-600-5 |
| Molecular Formula: | C7H7 Cl S |
| Molecular Weight: | 158.65 |
| InChI: | InChI=1/C7H7ClS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 90°C |
| Density: | 1.22 |
| Refractive index: | 1.598 |
| Appearance: | White crystalline power |
| Specification: | clear colorless to light yellow liquid Safety Statements:23-26-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 90°C |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
