| Identification | |
| Name: | 2-Methylvaleraldehyde |
| Synonyms: | 2-Methylpentanal; alpha-Methyl valeraldehyde; methyl valeraldehyde; |
| CAS: | 123-15-9 |
| EINECS: | 204-605-2 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-3-4-6(2)5-7/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2367 |
| Melting Point: | -60 C |
| Flash Point: | 62? |
| Density: | 0.808 |
| Stability: | No data. |
| Refractive index: | 1.401 |
| Water Solubility: | very slightly soluble |
| Solubility: | very slightly soluble |
| Appearance: | Clear liquid |
| Packinggroup: | II |
| Flash Point: | 62? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Air Sensitive |
| Color: | COLORLESS LIQUID |
| Usage: | Flavoring ingredient. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
