Identification |
Name: | 4-Nonanol,2,6,8-trimethyl- |
Synonyms: | 2,6,8-Trimethyl-4-nonanol;NSC 60574; |
CAS: | 123-17-1 |
EINECS: | 204-606-8 |
Molecular Formula: | C12H26 O |
Molecular Weight: | 186.33 |
InChI: | InChI=1/C12H26O/c1-9(2)6-11(5)8-12(13)7-10(3)4/h9-13H,6-8H2,1-5H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 94.3°C |
Density: | 0.81 |
Refractive index: | 1.4350 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 94.3°C |
Safety Data |
|
|