| Identification | |
| Name: | 4-Nonanol,2,6,8-trimethyl- |
| Synonyms: | 2,6,8-Trimethyl-4-nonanol;NSC 60574; |
| CAS: | 123-17-1 |
| EINECS: | 204-606-8 |
| Molecular Formula: | C12H26 O |
| Molecular Weight: | 186.33 |
| InChI: | InChI=1/C12H26O/c1-9(2)6-11(5)8-12(13)7-10(3)4/h9-13H,6-8H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 94.3°C |
| Density: | 0.81 |
| Refractive index: | 1.4350 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 94.3°C |
| Safety Data | |
 |
|
